About 3a-methyl-1,4-dihydrobenzimidazol-2-amine
3a-methyl-1,4-dihydrobenzimidazol-2-amine (PubChem CID 160709605) has the molecular formula C8H11N3
and a molecular weight of 149.20 g/mol. Its IUPAC name is 3a-methyl-1,4-dihydrobenzimidazol-2-amine.
Molecular Properties
| Compound Name | 3a-methyl-1,4-dihydrobenzimidazol-2-amine |
| PubChem CID | 160709605 |
| Molecular Formula | C8H11N3 |
| Molecular Weight | 149.20 g/mol |
| Exact Mass | 149.10 |
| IUPAC Name | 3a-methyl-1,4-dihydrobenzimidazol-2-amine |
| SMILES | CC12CC=CC=C1NC(N)=N2 |
| InChI | InChI=1S/C8H11N3/c1-8-5-3-2-4-6(8)10-7(9)11-8/h2-4H,5H2,1H3,(H3,9,10,11) |
| InChIKey | RRRIDSGROUKVIR-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.20 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3a-methyl-1,4-dihydrobenzimidazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3a-methyl-1,4-dihydrobenzimidazol-2-amine?
The IUPAC name of 3a-methyl-1,4-dihydrobenzimidazol-2-amine (CID 160709605) is 3a-methyl-1,4-dihydrobenzimidazol-2-amine.
What is the SMILES notation for 3a-methyl-1,4-dihydrobenzimidazol-2-amine?
The canonical SMILES for 3a-methyl-1,4-dihydrobenzimidazol-2-amine is CC12CC=CC=C1NC(N)=N2.
What is the InChIKey of 3a-methyl-1,4-dihydrobenzimidazol-2-amine?
The InChIKey is RRRIDSGROUKVIR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N3/c1-8-5-3-2-4-6(8)10-7(9)11-8/h2-4H,5H2,1H3,(H3,9,10,11).
What are the key properties of 3a-methyl-1,4-dihydrobenzimidazol-2-amine?
3a-methyl-1,4-dihydrobenzimidazol-2-amine has a molecular weight of 149.20 g/mol, XLogP of 0.51, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3a-methyl-1,4-dihydrobenzimidazol-2-amine is sourced from PubChem (CID 160709605), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).