C25H35N7 — CID 160710266
N-methyl-N-[[4-methyl-5-[[1-(3H-pyrrol-2-ylmethyl)piperidin-4-yl]methyl]-1,2,4-triazol-3-yl]methyl]-5,6,7,8-tetrahydroquinolin-8-amine (PubChem CID 160710266) has the molecular formula C25H35N7 and a molecular weight of 433.60 g/mol. Its IUPAC name is N-methyl-N-[[4-methyl-5-[[1-(3H-pyrrol-2-ylmethyl)piperidin-4-yl]methyl]-1,2,4-triazol-3-yl]methyl]-5,6,7,8-tetrahydroquinolin-8-amine.
| Compound Name | N-methyl-N-[[4-methyl-5-[[1-(3H-pyrrol-2-ylmethyl)piperidin-4-yl]methyl]-1,2,4-triazol-3-yl]methyl]-5,6,7,8-tetrahydroquinolin-8-amine |
|---|---|
| PubChem CID | 160710266 |
| Molecular Formula | C25H35N7 |
| Molecular Weight | 433.60 g/mol |
| Exact Mass | 433.30 |
| IUPAC Name | N-methyl-N-[[4-methyl-5-[[1-(3H-pyrrol-2-ylmethyl)piperidin-4-yl]methyl]-1,2,4-triazol-3-yl]methyl]-5,6,7,8-tetrahydroquinolin-8-amine |
| SMILES | CN(Cc1nnc(CC2CCN(CC3=NC=CC3)CC2)n1C)C1CCCc2cccnc21 |
| InChI | InChI=1S/C25H35N7/c1-30(22-9-3-6-20-7-4-13-27-25(20)22)18-24-29-28-23(31(24)2)16-19-10-14-32(15-11-19)17-21-8-5-12-26-21/h4-5,7,12-13,19,22H,3,6,8-11,14-18H2,1-2H3 |
| InChIKey | FNMSXEPBQPBCQN-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 62.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.60 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |