C18H17N5 — CID 160710902
3-ethynyl-5-(2-piperazin-1-yl-4-pyridinyl)-1H-pyrrolo[2,3-b]pyridine (PubChem CID 160710902) has the molecular formula C18H17N5 and a molecular weight of 303.37 g/mol. Its IUPAC name is 3-ethynyl-5-(2-piperazin-1-yl-4-pyridinyl)-1H-pyrrolo[2,3-b]pyridine.
| Compound Name | 3-ethynyl-5-(2-piperazin-1-yl-4-pyridinyl)-1H-pyrrolo[2,3-b]pyridine |
|---|---|
| PubChem CID | 160710902 |
| Molecular Formula | C18H17N5 |
| Molecular Weight | 303.37 g/mol |
| Exact Mass | 303.15 |
| IUPAC Name | 3-ethynyl-5-(2-piperazin-1-yl-4-pyridinyl)-1H-pyrrolo[2,3-b]pyridine |
| SMILES | C#Cc1c[nH]c2ncc(-c3ccnc(N4CCNCC4)c3)cc12 |
| InChI | InChI=1S/C18H17N5/c1-2-13-11-21-18-16(13)9-15(12-22-18)14-3-4-20-17(10-14)23-7-5-19-6-8-23/h1,3-4,9-12,19H,5-8H2,(H,21,22) |
| InChIKey | RABJZCDZPWMFGU-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.37 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|