About 4,5-difluoro-1H-benzimidazole;penta-1,3-diyne
4,5-difluoro-1H-benzimidazole;penta-1,3-diyne (PubChem CID 160711396) has the molecular formula C12H8F2N2
and a molecular weight of 218.21 g/mol. Its IUPAC name is 4,5-difluoro-1H-benzimidazole;penta-1,3-diyne.
Molecular Properties
| Compound Name | 4,5-difluoro-1H-benzimidazole;penta-1,3-diyne |
| PubChem CID | 160711396 |
| Molecular Formula | C12H8F2N2 |
| Molecular Weight | 218.21 g/mol |
| Exact Mass | 218.07 |
| IUPAC Name | 4,5-difluoro-1H-benzimidazole;penta-1,3-diyne |
| SMILES | C#CC#CC.Fc1ccc2[nH]cnc2c1F |
| InChI | InChI=1S/C7H4F2N2.C5H4/c8-4-1-2-5-7(6(4)9)11-3-10-5;1-3-5-4-2/h1-3H,(H,10,11);1H,2H3 |
| InChIKey | RRXFSPVBGDWASL-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.21 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 4,5-difluoro-1H-benzimidazole;penta-1,3-diyne with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-difluoro-1H-benzimidazole;penta-1,3-diyne?
The IUPAC name of 4,5-difluoro-1H-benzimidazole;penta-1,3-diyne (CID 160711396) is 4,5-difluoro-1H-benzimidazole;penta-1,3-diyne.
What is the SMILES notation for 4,5-difluoro-1H-benzimidazole;penta-1,3-diyne?
The canonical SMILES for 4,5-difluoro-1H-benzimidazole;penta-1,3-diyne is C#CC#CC.Fc1ccc2[nH]cnc2c1F.
What is the InChIKey of 4,5-difluoro-1H-benzimidazole;penta-1,3-diyne?
The InChIKey is RRXFSPVBGDWASL-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H4F2N2.C5H4/c8-4-1-2-5-7(6(4)9)11-3-10-5;1-3-5-4-2/h1-3H,(H,10,11);1H,2H3.
What are the key properties of 4,5-difluoro-1H-benzimidazole;penta-1,3-diyne?
4,5-difluoro-1H-benzimidazole;penta-1,3-diyne has a molecular weight of 218.21 g/mol, XLogP of 2.48, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-difluoro-1H-benzimidazole;penta-1,3-diyne is sourced from PubChem (CID 160711396), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).