C15H19ClO — CID 160711595
(3aR,9bR)-6-chloro-7-methoxy-3a-methyl-1,2,3,4,5,9b-hexahydrocyclopenta[a]naphthalene (PubChem CID 160711595) has the molecular formula C15H19ClO and a molecular weight of 250.77 g/mol. Its IUPAC name is (3aR,9bR)-6-chloro-7-methoxy-3a-methyl-1,2,3,4,5,9b-hexahydrocyclopenta[a]naphthalene.
| Compound Name | (3aR,9bR)-6-chloro-7-methoxy-3a-methyl-1,2,3,4,5,9b-hexahydrocyclopenta[a]naphthalene |
|---|---|
| PubChem CID | 160711595 |
| Molecular Formula | C15H19ClO |
| Molecular Weight | 250.77 g/mol |
| Exact Mass | 250.11 |
| IUPAC Name | (3aR,9bR)-6-chloro-7-methoxy-3a-methyl-1,2,3,4,5,9b-hexahydrocyclopenta[a]naphthalene |
| SMILES | COc1ccc2c(c1Cl)CC[C@@]1(C)CCC[C@@H]21 |
| InChI | InChI=1S/C15H19ClO/c1-15-8-3-4-12(15)10-5-6-13(17-2)14(16)11(10)7-9-15/h5-6,12H,3-4,7-9H2,1-2H3/t12-,15+/m0/s1 |
| InChIKey | RWSRZXREHXLZFV-SWLSCSKDSA-N |
| XLogP | 4.57 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.77 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |