C17H22 — CID 160711596
(3aR,9bS)-6-cyclopropyl-3a-methyl-1,2,3,4,5,9b-hexahydrocyclopenta[a]naphthalene (PubChem CID 160711596) has the molecular formula C17H22 and a molecular weight of 226.36 g/mol. Its IUPAC name is (3aR,9bS)-6-cyclopropyl-3a-methyl-1,2,3,4,5,9b-hexahydrocyclopenta[a]naphthalene.
| Compound Name | (3aR,9bS)-6-cyclopropyl-3a-methyl-1,2,3,4,5,9b-hexahydrocyclopenta[a]naphthalene |
|---|---|
| PubChem CID | 160711596 |
| Molecular Formula | C17H22 |
| Molecular Weight | 226.36 g/mol |
| Exact Mass | 226.17 |
| IUPAC Name | (3aR,9bS)-6-cyclopropyl-3a-methyl-1,2,3,4,5,9b-hexahydrocyclopenta[a]naphthalene |
| SMILES | C[C@]12CCC[C@@H]1c1cccc(C3CC3)c1CC2 |
| InChI | InChI=1S/C17H22/c1-17-10-3-6-16(17)15-5-2-4-13(12-7-8-12)14(15)9-11-17/h2,4-5,12,16H,3,6-11H2,1H3/t16-,17-/m1/s1 |
| InChIKey | VFBOQSUDYHJXGV-IAGOWNOFSA-N |
| XLogP | 4.78 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.36 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |