About N-[(2S)-3-(4-cyano-2,6-dimethylphenyl)-1-methoxy-1-oxopropan-2-yl]-methylboronamidic acid;sulfane
N-[(2S)-3-(4-cyano-2,6-dimethylphenyl)-1-methoxy-1-oxopropan-2-yl]-methylboronamidic acid;sulfane (PubChem CID 160711666) has the molecular formula C14H21BN2O3S
and a molecular weight of 308.21 g/mol. Its IUPAC name is N-[(2S)-3-(4-cyano-2,6-dimethylphenyl)-1-methoxy-1-oxopropan-2-yl]-methylboronamidic acid;sulfane.
Molecular Properties
| Compound Name | N-[(2S)-3-(4-cyano-2,6-dimethylphenyl)-1-methoxy-1-oxopropan-2-yl]-methylboronamidic acid;sulfane |
| PubChem CID | 160711666 |
| Molecular Formula | C14H21BN2O3S |
| Molecular Weight | 308.21 g/mol |
| Exact Mass | 308.14 |
| IUPAC Name | N-[(2S)-3-(4-cyano-2,6-dimethylphenyl)-1-methoxy-1-oxopropan-2-yl]-methylboronamidic acid;sulfane |
| SMILES | COC(=O)[C@H](Cc1c(C)cc(C#N)cc1C)NB(C)O.S |
| InChI | InChI=1S/C14H19BN2O3.H2S/c1-9-5-11(8-16)6-10(2)12(9)7-13(14(18)20-4)17-15(3)19;/h5-6,13,17,19H,7H2,1-4H3;1H2/t13-;/m0./s1 |
| InChIKey | RRYBNDRWCKLEFV-ZOWNYOTGSA-N |
| XLogP | 1.07 |
| TPSA | 82.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.21 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze N-[(2S)-3-(4-cyano-2,6-dimethylphenyl)-1-methoxy-1-oxopropan-2-yl]-methylboronamidic acid;sulfane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(2S)-3-(4-cyano-2,6-dimethylphenyl)-1-methoxy-1-oxopropan-2-yl]-methylboronamidic acid;sulfane?
The IUPAC name of N-[(2S)-3-(4-cyano-2,6-dimethylphenyl)-1-methoxy-1-oxopropan-2-yl]-methylboronamidic acid;sulfane (CID 160711666) is N-[(2S)-3-(4-cyano-2,6-dimethylphenyl)-1-methoxy-1-oxopropan-2-yl]-methylboronamidic acid;sulfane.
What is the SMILES notation for N-[(2S)-3-(4-cyano-2,6-dimethylphenyl)-1-methoxy-1-oxopropan-2-yl]-methylboronamidic acid;sulfane?
The canonical SMILES for N-[(2S)-3-(4-cyano-2,6-dimethylphenyl)-1-methoxy-1-oxopropan-2-yl]-methylboronamidic acid;sulfane is COC(=O)[C@H](Cc1c(C)cc(C#N)cc1C)NB(C)O.S.
What is the InChIKey of N-[(2S)-3-(4-cyano-2,6-dimethylphenyl)-1-methoxy-1-oxopropan-2-yl]-methylboronamidic acid;sulfane?
The InChIKey is RRYBNDRWCKLEFV-ZOWNYOTGSA-N. The full InChI is InChI=1S/C14H19BN2O3.H2S/c1-9-5-11(8-16)6-10(2)12(9)7-13(14(18)20-4)17-15(3)19;/h5-6,13,17,19H,7H2,1-4H3;1H2/t13-;/m0./s1.
What are the key properties of N-[(2S)-3-(4-cyano-2,6-dimethylphenyl)-1-methoxy-1-oxopropan-2-yl]-methylboronamidic acid;sulfane?
N-[(2S)-3-(4-cyano-2,6-dimethylphenyl)-1-methoxy-1-oxopropan-2-yl]-methylboronamidic acid;sulfane has a molecular weight of 308.21 g/mol, XLogP of 1.07, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2S)-3-(4-cyano-2,6-dimethylphenyl)-1-methoxy-1-oxopropan-2-yl]-methylboronamidic acid;sulfane is sourced from PubChem (CID 160711666), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).