C29H29N3O4 — CID 160712668
7-[2-(3,3-dimethyl-4-prop-2-enoyl-2H-1,4-benzoxazin-6-yl)acetyl]spiro[2,3-dihydropyrazino[1,2-a]indole-4,1'-cyclobutane]-1-one (PubChem CID 160712668) has the molecular formula C29H29N3O4 and a molecular weight of 483.57 g/mol. Its IUPAC name is 7-[2-(3,3-dimethyl-4-prop-2-enoyl-2H-1,4-benzoxazin-6-yl)acetyl]spiro[2,3-dihydropyrazino[1,2-a]indole-4,1'-cyclobutane]-1-one.
| Compound Name | 7-[2-(3,3-dimethyl-4-prop-2-enoyl-2H-1,4-benzoxazin-6-yl)acetyl]spiro[2,3-dihydropyrazino[1,2-a]indole-4,1'-cyclobutane]-1-one |
|---|---|
| PubChem CID | 160712668 |
| Molecular Formula | C29H29N3O4 |
| Molecular Weight | 483.57 g/mol |
| Exact Mass | 483.22 |
| IUPAC Name | 7-[2-(3,3-dimethyl-4-prop-2-enoyl-2H-1,4-benzoxazin-6-yl)acetyl]spiro[2,3-dihydropyrazino[1,2-a]indole-4,1'-cyclobutane]-1-one |
| SMILES | C=CC(=O)N1c2cc(CC(=O)c3ccc4cc5n(c4c3)C3(CCC3)CNC5=O)ccc2OCC1(C)C |
| InChI | InChI=1S/C29H29N3O4/c1-4-26(34)32-22-12-18(6-9-25(22)36-17-28(32,2)3)13-24(33)20-8-7-19-14-23-27(35)30-16-29(10-5-11-29)31(23)21(19)15-20/h4,6-9,12,14-15H,1,5,10-11,13,16-17H2,2-3H3,(H,30,35) |
| InChIKey | RSBHUXXGKSFTON-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 80.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.57 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|