C26H35N3O3S2 — CID 160713497
2,2-dimethylpropane;N'-(1,1-dioxothian-4-yl)-5-ethyl-4-oxo-7-phenylthieno[3,2-c]pyridine-2-carboximidamide (PubChem CID 160713497) has the molecular formula C26H35N3O3S2 and a molecular weight of 501.72 g/mol. Its IUPAC name is 2,2-dimethylpropane;N'-(1,1-dioxothian-4-yl)-5-ethyl-4-oxo-7-phenylthieno[3,2-c]pyridine-2-carboximidamide.
| Compound Name | 2,2-dimethylpropane;N'-(1,1-dioxothian-4-yl)-5-ethyl-4-oxo-7-phenylthieno[3,2-c]pyridine-2-carboximidamide |
|---|---|
| PubChem CID | 160713497 |
| Molecular Formula | C26H35N3O3S2 |
| Molecular Weight | 501.72 g/mol |
| Exact Mass | 501.21 |
| IUPAC Name | 2,2-dimethylpropane;N'-(1,1-dioxothian-4-yl)-5-ethyl-4-oxo-7-phenylthieno[3,2-c]pyridine-2-carboximidamide |
| SMILES | CC(C)(C)C.CCn1cc(-c2ccccc2)c2sc(/C(N)=N/C3CCS(=O)(=O)CC3)cc2c1=O |
| InChI | InChI=1S/C21H23N3O3S2.C5H12/c1-2-24-13-17(14-6-4-3-5-7-14)19-16(21(24)25)12-18(28-19)20(22)23-15-8-10-29(26,27)11-9-15;1-5(2,3)4/h3-7,12-13,15H,2,8-11H2,1H3,(H2,22,23);1-4H3 |
| InChIKey | RSDYRBZFBTYGKK-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 94.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.72 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|