C60H66N2 — CID 160713603
CID 160713603 (PubChem CID 160713603) has the molecular formula C60H66N2 and a molecular weight of 818.22 g/mol.
| Compound Name | CID 160713603 |
|---|---|
| PubChem CID | 160713603 |
| Molecular Formula | C60H66N2 |
| Molecular Weight | 818.22 g/mol |
| Exact Mass | 817.54 |
| IUPAC Name | — |
| SMILES | CC(C)c1ccc(N(c2ccc(C3CCCCC3)cc2)c2cc3c4ccccc4c(N(c4ccc(C(C)C)cc4)c4ccc(C5CCCCC5)cc4)cc3c3ccccc23)cc1.[2H][2H].[H][2H] |
| InChI | InChI=1S/C60H62N2.2H2/c1-41(2)43-23-31-49(32-24-43)61(51-35-27-47(28-36-51)45-15-7-5-8-16-45)59-39-57-54-20-12-14-22-56(54)60(40-58(57)53-19-11-13-21-55(53)59)62(50-33-25-44(26-34-50)42(3)4)52-37-29-48(30-38-52)46-17-9-6-10-18-46;;/h11-14,19-42,45-46H,5-10,15-18H2,1-4H3;2*1H/i;1+1D;1+1 |
| InChIKey | RSEHVQRWVGVJJS-AJNBRFAESA-N |
| XLogP | 18.92 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 818.22 |
| LogP ≤ 5 | 18.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|