C18H26Br2F2O4 — CID 160715573
dibromo(difluoro)methane;(2,2,5,10-tetramethyl-4,6a,7,8,9,10-hexahydro-3aH-benzo[h][1,3]benzodioxol-4-yl) acetate (PubChem CID 160715573) has the molecular formula C18H26Br2F2O4 and a molecular weight of 504.21 g/mol. Its IUPAC name is dibromo(difluoro)methane;(2,2,5,10-tetramethyl-4,6a,7,8,9,10-hexahydro-3aH-benzo[h][1,3]benzodioxol-4-yl) acetate.
| Compound Name | dibromo(difluoro)methane;(2,2,5,10-tetramethyl-4,6a,7,8,9,10-hexahydro-3aH-benzo[h][1,3]benzodioxol-4-yl) acetate |
|---|---|
| PubChem CID | 160715573 |
| Molecular Formula | C18H26Br2F2O4 |
| Molecular Weight | 504.21 g/mol |
| Exact Mass | 502.02 |
| IUPAC Name | dibromo(difluoro)methane;(2,2,5,10-tetramethyl-4,6a,7,8,9,10-hexahydro-3aH-benzo[h][1,3]benzodioxol-4-yl) acetate |
| SMILES | CC(=O)OC1C(C)=CC2CCCC(C)C23OC(C)(C)OC13.FC(F)(Br)Br |
| InChI | InChI=1S/C17H26O4.CBr2F2/c1-10-9-13-8-6-7-11(2)17(13)15(14(10)19-12(3)18)20-16(4,5)21-17;2-1(3,4)5/h9,11,13-15H,6-8H2,1-5H3; |
| InChIKey | RSKQUEASXRUDTG-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.21 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|