C23H20FN2S+ — CID 160716030
[4-[5-(4-fluorophenyl)-4-pyridin-4-yl-3H-pyrrol-2-yl]phenyl]-dimethylsulfanium (PubChem CID 160716030) has the molecular formula C23H20FN2S+ and a molecular weight of 375.49 g/mol. Its IUPAC name is [4-[5-(4-fluorophenyl)-4-pyridin-4-yl-3H-pyrrol-2-yl]phenyl]-dimethylsulfanium.
| Compound Name | [4-[5-(4-fluorophenyl)-4-pyridin-4-yl-3H-pyrrol-2-yl]phenyl]-dimethylsulfanium |
|---|---|
| PubChem CID | 160716030 |
| Molecular Formula | C23H20FN2S+ |
| Molecular Weight | 375.49 g/mol |
| Exact Mass | 375.13 |
| IUPAC Name | [4-[5-(4-fluorophenyl)-4-pyridin-4-yl-3H-pyrrol-2-yl]phenyl]-dimethylsulfanium |
| SMILES | C[S+](C)c1ccc(C2=NC(c3ccc(F)cc3)=C(c3ccncc3)C2)cc1 |
| InChI | InChI=1S/C23H20FN2S/c1-27(2)20-9-5-17(6-10-20)22-15-21(16-11-13-25-14-12-16)23(26-22)18-3-7-19(24)8-4-18/h3-14H,15H2,1-2H3/q+1 |
| InChIKey | ZPJHYKFISPYFAN-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 25.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.49 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|