C17H39N4O+ — CID 160716327
2-[(2,8-diamino-2-methylnonanoyl)amino]ethyl-diethyl-methylazanium (PubChem CID 160716327) has the molecular formula C17H39N4O+ and a molecular weight of 315.53 g/mol. Its IUPAC name is 2-[(2,8-diamino-2-methylnonanoyl)amino]ethyl-diethyl-methylazanium.
| Compound Name | 2-[(2,8-diamino-2-methylnonanoyl)amino]ethyl-diethyl-methylazanium |
|---|---|
| PubChem CID | 160716327 |
| Molecular Formula | C17H39N4O+ |
| Molecular Weight | 315.53 g/mol |
| Exact Mass | 315.31 |
| IUPAC Name | 2-[(2,8-diamino-2-methylnonanoyl)amino]ethyl-diethyl-methylazanium |
| SMILES | CC[N+](C)(CC)CCNC(=O)C(C)(N)CCCCCC(C)N |
| InChI | InChI=1S/C17H38N4O/c1-6-21(5,7-2)14-13-20-16(22)17(4,19)12-10-8-9-11-15(3)18/h15H,6-14,18-19H2,1-5H3/p+1 |
| InChIKey | NBOAUZXLEONHPA-UHFFFAOYSA-O |
| XLogP | 1.60 |
| TPSA | 81.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.53 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|