C24H41NO6Si2 — CID 160718802
4-[2,3-bis(2-trimethylsilylethoxymethoxy)phenyl]-3,6-dihydro-2H-pyridine-1-carboxylic acid (PubChem CID 160718802) has the molecular formula C24H41NO6Si2 and a molecular weight of 495.77 g/mol. Its IUPAC name is 4-[2,3-bis(2-trimethylsilylethoxymethoxy)phenyl]-3,6-dihydro-2H-pyridine-1-carboxylic acid.
| Compound Name | 4-[2,3-bis(2-trimethylsilylethoxymethoxy)phenyl]-3,6-dihydro-2H-pyridine-1-carboxylic acid |
|---|---|
| PubChem CID | 160718802 |
| Molecular Formula | C24H41NO6Si2 |
| Molecular Weight | 495.77 g/mol |
| Exact Mass | 495.25 |
| IUPAC Name | 4-[2,3-bis(2-trimethylsilylethoxymethoxy)phenyl]-3,6-dihydro-2H-pyridine-1-carboxylic acid |
| SMILES | C[Si](C)(C)CCOCOc1cccc(C2=CCN(C(=O)O)CC2)c1OCOCC[Si](C)(C)C |
| InChI | InChI=1S/C24H41NO6Si2/c1-32(2,3)16-14-28-18-30-22-9-7-8-21(20-10-12-25(13-11-20)24(26)27)23(22)31-19-29-15-17-33(4,5)6/h7-10H,11-19H2,1-6H3,(H,26,27) |
| InChIKey | RSVBCKKJCUHVBF-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 77.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.77 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|