About 1-phenylpyrrolo[3,2-b]pyridine;1H-pyrrolo[3,2-b]pyridine
1-phenylpyrrolo[3,2-b]pyridine;1H-pyrrolo[3,2-b]pyridine (PubChem CID 160719187) has the molecular formula C20H16N4
and a molecular weight of 312.38 g/mol. Its IUPAC name is 1-phenylpyrrolo[3,2-b]pyridine;1H-pyrrolo[3,2-b]pyridine.
Molecular Properties
| Compound Name | 1-phenylpyrrolo[3,2-b]pyridine;1H-pyrrolo[3,2-b]pyridine |
| PubChem CID | 160719187 |
| Molecular Formula | C20H16N4 |
| Molecular Weight | 312.38 g/mol |
| Exact Mass | 312.14 |
| IUPAC Name | 1-phenylpyrrolo[3,2-b]pyridine;1H-pyrrolo[3,2-b]pyridine |
| SMILES | c1ccc(-n2ccc3ncccc32)cc1.c1cnc2cc[nH]c2c1 |
| InChI | InChI=1S/C13H10N2.C7H6N2/c1-2-5-11(6-3-1)15-10-8-12-13(15)7-4-9-14-12;1-2-6-7(8-4-1)3-5-9-6/h1-10H;1-5,9H |
| InChIKey | RSWKLPDRWSJROO-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 46.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.38 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-phenylpyrrolo[3,2-b]pyridine;1H-pyrrolo[3,2-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-phenylpyrrolo[3,2-b]pyridine;1H-pyrrolo[3,2-b]pyridine?
The IUPAC name of 1-phenylpyrrolo[3,2-b]pyridine;1H-pyrrolo[3,2-b]pyridine (CID 160719187) is 1-phenylpyrrolo[3,2-b]pyridine;1H-pyrrolo[3,2-b]pyridine.
What is the SMILES notation for 1-phenylpyrrolo[3,2-b]pyridine;1H-pyrrolo[3,2-b]pyridine?
The canonical SMILES for 1-phenylpyrrolo[3,2-b]pyridine;1H-pyrrolo[3,2-b]pyridine is c1ccc(-n2ccc3ncccc32)cc1.c1cnc2cc[nH]c2c1.
What is the InChIKey of 1-phenylpyrrolo[3,2-b]pyridine;1H-pyrrolo[3,2-b]pyridine?
The InChIKey is RSWKLPDRWSJROO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10N2.C7H6N2/c1-2-5-11(6-3-1)15-10-8-12-13(15)7-4-9-14-12;1-2-6-7(8-4-1)3-5-9-6/h1-10H;1-5,9H.
What are the key properties of 1-phenylpyrrolo[3,2-b]pyridine;1H-pyrrolo[3,2-b]pyridine?
1-phenylpyrrolo[3,2-b]pyridine;1H-pyrrolo[3,2-b]pyridine has a molecular weight of 312.38 g/mol, XLogP of 4.59, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-phenylpyrrolo[3,2-b]pyridine;1H-pyrrolo[3,2-b]pyridine is sourced from PubChem (CID 160719187), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).