C26H26F3NO4S — CID 160721306
4-[2-[3-(4-hydroxybutyl)-4-[2-(trifluoromethyl)phenyl]phenyl]-2-oxoethyl]-2-methylbenzenesulfonamide (PubChem CID 160721306) has the molecular formula C26H26F3NO4S and a molecular weight of 505.56 g/mol. Its IUPAC name is 4-[2-[3-(4-hydroxybutyl)-4-[2-(trifluoromethyl)phenyl]phenyl]-2-oxoethyl]-2-methylbenzenesulfonamide.
| Compound Name | 4-[2-[3-(4-hydroxybutyl)-4-[2-(trifluoromethyl)phenyl]phenyl]-2-oxoethyl]-2-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 160721306 |
| Molecular Formula | C26H26F3NO4S |
| Molecular Weight | 505.56 g/mol |
| Exact Mass | 505.15 |
| IUPAC Name | 4-[2-[3-(4-hydroxybutyl)-4-[2-(trifluoromethyl)phenyl]phenyl]-2-oxoethyl]-2-methylbenzenesulfonamide |
| SMILES | Cc1cc(CC(=O)c2ccc(-c3ccccc3C(F)(F)F)c(CCCCO)c2)ccc1S(N)(=O)=O |
| InChI | InChI=1S/C26H26F3NO4S/c1-17-14-18(9-12-25(17)35(30,33)34)15-24(32)20-10-11-21(19(16-20)6-4-5-13-31)22-7-2-3-8-23(22)26(27,28)29/h2-3,7-12,14,16,31H,4-6,13,15H2,1H3,(H2,30,33,34) |
| InChIKey | ZRTPPBOCPCYMDP-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 97.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.56 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|