C34H36N6O4 — CID 160723700
N-benzyl-1-pyridin-2-ylmethanimine;ethyl (2R,3S)-1-benzyl-3-pyridin-2-ylaziridine-2-carboxylate;ethyl 2-diazoacetate (PubChem CID 160723700) has the molecular formula C34H36N6O4 and a molecular weight of 592.70 g/mol. Its IUPAC name is N-benzyl-1-pyridin-2-ylmethanimine;ethyl (2R,3S)-1-benzyl-3-pyridin-2-ylaziridine-2-carboxylate;ethyl 2-diazoacetate.
| Compound Name | N-benzyl-1-pyridin-2-ylmethanimine;ethyl (2R,3S)-1-benzyl-3-pyridin-2-ylaziridine-2-carboxylate;ethyl 2-diazoacetate |
|---|---|
| PubChem CID | 160723700 |
| Molecular Formula | C34H36N6O4 |
| Molecular Weight | 592.70 g/mol |
| Exact Mass | 592.28 |
| IUPAC Name | N-benzyl-1-pyridin-2-ylmethanimine;ethyl (2R,3S)-1-benzyl-3-pyridin-2-ylaziridine-2-carboxylate;ethyl 2-diazoacetate |
| SMILES | C(=N/Cc1ccccc1)\c1ccccn1.CCOC(=O)C=[N+]=[N-].CCOC(=O)[C@H]1[C@@H](c2ccccn2)N1Cc1ccccc1 |
| InChI | InChI=1S/C17H18N2O2.C13H12N2.C4H6N2O2/c1-2-21-17(20)16-15(14-10-6-7-11-18-14)19(16)12-13-8-4-3-5-9-13;1-2-6-12(7-3-1)10-14-11-13-8-4-5-9-15-13;1-2-8-4(7)3-6-5/h3-11,15-16H,2,12H2,1H3;1-9,11H,10H2;3H,2H2,1H3/b;14-11+;/t15-,16-,19?;;/m1../s1 |
| InChIKey | RTKUNTCHEQXXJA-RRQPKXLBSA-N |
| XLogP | 5.12 |
| TPSA | 130.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.70 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|