C24H29FN2O2S2 — CID 160724811
1-[3-(5-fluoro-1,3-benzothiazol-2-yl)-5,7-dimethyl-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-2-yl]-7-methoxyheptan-2-one (PubChem CID 160724811) has the molecular formula C24H29FN2O2S2 and a molecular weight of 460.64 g/mol. Its IUPAC name is 1-[3-(5-fluoro-1,3-benzothiazol-2-yl)-5,7-dimethyl-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-2-yl]-7-methoxyheptan-2-one.
| Compound Name | 1-[3-(5-fluoro-1,3-benzothiazol-2-yl)-5,7-dimethyl-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-2-yl]-7-methoxyheptan-2-one |
|---|---|
| PubChem CID | 160724811 |
| Molecular Formula | C24H29FN2O2S2 |
| Molecular Weight | 460.64 g/mol |
| Exact Mass | 460.17 |
| IUPAC Name | 1-[3-(5-fluoro-1,3-benzothiazol-2-yl)-5,7-dimethyl-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-2-yl]-7-methoxyheptan-2-one |
| SMILES | COCCCCCC(=O)Cc1sc2c(c1-c1nc3cc(F)ccc3s1)CC(C)NC2C |
| InChI | InChI=1S/C24H29FN2O2S2/c1-14-11-18-22(24-27-19-12-16(25)8-9-20(19)31-24)21(30-23(18)15(2)26-14)13-17(28)7-5-4-6-10-29-3/h8-9,12,14-15,26H,4-7,10-11,13H2,1-3H3 |
| InChIKey | VQDBYDMXQIUVTC-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.64 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|