C10H3F8IO4 — CID 160725672
[acetyloxy-(2,3,4,5,6-pentafluorophenyl)-λ3-iodanyl] 2,2,2-trifluoroacetate (PubChem CID 160725672) has the molecular formula C10H3F8IO4 and a molecular weight of 466.02 g/mol. Its IUPAC name is [acetyloxy-(2,3,4,5,6-pentafluorophenyl)-λ3-iodanyl] 2,2,2-trifluoroacetate.
| Compound Name | [acetyloxy-(2,3,4,5,6-pentafluorophenyl)-λ3-iodanyl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 160725672 |
| Molecular Formula | C10H3F8IO4 |
| Molecular Weight | 466.02 g/mol |
| Exact Mass | 465.89 |
| IUPAC Name | [acetyloxy-(2,3,4,5,6-pentafluorophenyl)-λ3-iodanyl] 2,2,2-trifluoroacetate |
| SMILES | CC(=O)OI(OC(=O)C(F)(F)F)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C10H3F8IO4/c1-2(20)22-19(23-9(21)10(16,17)18)8-6(14)4(12)3(11)5(13)7(8)15/h1H3 |
| InChIKey | SKNLCIKQWVNMOF-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.02 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|