C14H33N11 — CID 160725872
1,3,5,7-tetrazabicyclo[3.3.1]nonane;1,3,5,7-tetrazatricyclo[3.3.1.13,7]decane;1,3,5-triazinane (PubChem CID 160725872) has the molecular formula C14H33N11 and a molecular weight of 355.50 g/mol. Its IUPAC name is 1,3,5,7-tetrazabicyclo[3.3.1]nonane;1,3,5,7-tetrazatricyclo[3.3.1.13,7]decane;1,3,5-triazinane.
| Compound Name | 1,3,5,7-tetrazabicyclo[3.3.1]nonane;1,3,5,7-tetrazatricyclo[3.3.1.13,7]decane;1,3,5-triazinane |
|---|---|
| PubChem CID | 160725872 |
| Molecular Formula | C14H33N11 |
| Molecular Weight | 355.50 g/mol |
| Exact Mass | 355.29 |
| IUPAC Name | 1,3,5,7-tetrazabicyclo[3.3.1]nonane;1,3,5,7-tetrazatricyclo[3.3.1.13,7]decane;1,3,5-triazinane |
| SMILES | C1N2CN3CN1CN(C2)C3.C1NCN2CNCN1C2.C1NCNCN1 |
| InChI | InChI=1S/C6H12N4.C5H12N4.C3H9N3/c1-7-2-9-4-8(1)5-10(3-7)6-9;1-6-2-9-4-7-3-8(1)5-9;1-4-2-6-3-5-1/h1-6H2;6-7H,1-5H2;4-6H,1-3H2 |
| InChIKey | RTRWLIHXKAPCQK-UHFFFAOYSA-N |
| XLogP | -3.79 |
| TPSA | 79.59 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.50 |
| LogP ≤ 5 | -3.79 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |