About tert-butyl carbonochloridate;1-methylpiperidine
tert-butyl carbonochloridate;1-methylpiperidine (PubChem CID 160726872) has the molecular formula C11H22ClNO2
and a molecular weight of 235.75 g/mol. Its IUPAC name is tert-butyl carbonochloridate;1-methylpiperidine.
Molecular Properties
| Compound Name | tert-butyl carbonochloridate;1-methylpiperidine |
| PubChem CID | 160726872 |
| Molecular Formula | C11H22ClNO2 |
| Molecular Weight | 235.75 g/mol |
| Exact Mass | 235.13 |
| IUPAC Name | tert-butyl carbonochloridate;1-methylpiperidine |
| SMILES | CC(C)(C)OC(=O)Cl.CN1CCCCC1 |
| InChI | InChI=1S/C6H13N.C5H9ClO2/c1-7-5-3-2-4-6-7;1-5(2,3)8-4(6)7/h2-6H2,1H3;1-3H3 |
| InChIKey | RTVBMKBWNIZKMX-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.75 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl carbonochloridate;1-methylpiperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl carbonochloridate;1-methylpiperidine?
The IUPAC name of tert-butyl carbonochloridate;1-methylpiperidine (CID 160726872) is tert-butyl carbonochloridate;1-methylpiperidine.
What is the SMILES notation for tert-butyl carbonochloridate;1-methylpiperidine?
The canonical SMILES for tert-butyl carbonochloridate;1-methylpiperidine is CC(C)(C)OC(=O)Cl.CN1CCCCC1.
What is the InChIKey of tert-butyl carbonochloridate;1-methylpiperidine?
The InChIKey is RTVBMKBWNIZKMX-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13N.C5H9ClO2/c1-7-5-3-2-4-6-7;1-5(2,3)8-4(6)7/h2-6H2,1H3;1-3H3.
What are the key properties of tert-butyl carbonochloridate;1-methylpiperidine?
tert-butyl carbonochloridate;1-methylpiperidine has a molecular weight of 235.75 g/mol, XLogP of 3.26, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl carbonochloridate;1-methylpiperidine is sourced from PubChem (CID 160726872), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).