C41H49F3N6O4S — CID 160727630
2-(benzotriazol-2-yl)-4-(2,4,4-trimethylpentan-2-yl)phenol;[2-(benzotriazol-2-yl)-4-(2,4,4-trimethylpentan-2-yl)phenyl] trifluoromethanesulfonate (PubChem CID 160727630) has the molecular formula C41H49F3N6O4S and a molecular weight of 778.94 g/mol. Its IUPAC name is 2-(benzotriazol-2-yl)-4-(2,4,4-trimethylpentan-2-yl)phenol;[2-(benzotriazol-2-yl)-4-(2,4,4-trimethylpentan-2-yl)phenyl] trifluoromethanesulfonate.
| Compound Name | 2-(benzotriazol-2-yl)-4-(2,4,4-trimethylpentan-2-yl)phenol;[2-(benzotriazol-2-yl)-4-(2,4,4-trimethylpentan-2-yl)phenyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 160727630 |
| Molecular Formula | C41H49F3N6O4S |
| Molecular Weight | 778.94 g/mol |
| Exact Mass | 778.35 |
| IUPAC Name | 2-(benzotriazol-2-yl)-4-(2,4,4-trimethylpentan-2-yl)phenol;[2-(benzotriazol-2-yl)-4-(2,4,4-trimethylpentan-2-yl)phenyl] trifluoromethanesulfonate |
| SMILES | CC(C)(C)CC(C)(C)c1ccc(O)c(-n2nc3ccccc3n2)c1.CC(C)(C)CC(C)(C)c1ccc(OS(=O)(=O)C(F)(F)F)c(-n2nc3ccccc3n2)c1 |
| InChI | InChI=1S/C21H24F3N3O3S.C20H25N3O/c1-19(2,3)13-20(4,5)14-10-11-18(30-31(28,29)21(22,23)24)17(12-14)27-25-15-8-6-7-9-16(15)26-27;1-19(2,3)13-20(4,5)14-10-11-18(24)17(12-14)23-21-15-8-6-7-9-16(15)22-23/h6-12H,13H2,1-5H3;6-12,24H,13H2,1-5H3 |
| InChIKey | RTXLZAGOLVDTFW-UHFFFAOYSA-N |
| XLogP | 10.20 |
| TPSA | 125.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 778.94 |
| LogP ≤ 5 | 10.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|