C27H51BrO5Si — CID 160728436
3-[(2S,4R)-6-[[(2S,3S,4R,5R)-3-(bromomethyl)-5-[(2R)-2-[tert-butyl(dimethyl)silyl]oxybutyl]-4-methoxyoxolan-2-yl]methyl]-4-methyl-5-methylideneoxan-2-yl]propan-1-ol (PubChem CID 160728436) has the molecular formula C27H51BrO5Si and a molecular weight of 563.69 g/mol. Its IUPAC name is 3-[(2S,4R)-6-[[(2S,3S,4R,5R)-3-(bromomethyl)-5-[(2R)-2-[tert-butyl(dimethyl)silyl]oxybutyl]-4-methoxyoxolan-2-yl]methyl]-4-methyl-5-methylideneoxan-2-yl]propan-1-ol.
| Compound Name | 3-[(2S,4R)-6-[[(2S,3S,4R,5R)-3-(bromomethyl)-5-[(2R)-2-[tert-butyl(dimethyl)silyl]oxybutyl]-4-methoxyoxolan-2-yl]methyl]-4-methyl-5-methylideneoxan-2-yl]propan-1-ol |
|---|---|
| PubChem CID | 160728436 |
| Molecular Formula | C27H51BrO5Si |
| Molecular Weight | 563.69 g/mol |
| Exact Mass | 562.27 |
| IUPAC Name | 3-[(2S,4R)-6-[[(2S,3S,4R,5R)-3-(bromomethyl)-5-[(2R)-2-[tert-butyl(dimethyl)silyl]oxybutyl]-4-methoxyoxolan-2-yl]methyl]-4-methyl-5-methylideneoxan-2-yl]propan-1-ol |
| SMILES | C=C1C(C[C@@H]2O[C@H](C[C@@H](CC)O[Si](C)(C)C(C)(C)C)[C@H](OC)[C@H]2CBr)O[C@@H](CCCO)C[C@H]1C |
| InChI | InChI=1S/C27H51BrO5Si/c1-10-20(33-34(8,9)27(4,5)6)15-25-26(30-7)22(17-28)24(32-25)16-23-19(3)18(2)14-21(31-23)12-11-13-29/h18,20-26,29H,3,10-17H2,1-2,4-9H3/t18-,20-,21+,22+,23?,24+,25-,26-/m1/s1 |
| InChIKey | NTCNXNHSPKBMBY-QEPZKLNJSA-N |
| XLogP | 6.48 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.69 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|