About methane;5-nitrocyclohexene-1-carbaldehyde;4-nitroheptanedial
methane;5-nitrocyclohexene-1-carbaldehyde;4-nitroheptanedial (PubChem CID 160729962) has the molecular formula C15H24N2O7
and a molecular weight of 344.36 g/mol. Its IUPAC name is methane;5-nitrocyclohexene-1-carbaldehyde;4-nitroheptanedial.
Molecular Properties
| Compound Name | methane;5-nitrocyclohexene-1-carbaldehyde;4-nitroheptanedial |
| PubChem CID | 160729962 |
| Molecular Formula | C15H24N2O7 |
| Molecular Weight | 344.36 g/mol |
| Exact Mass | 344.16 |
| IUPAC Name | methane;5-nitrocyclohexene-1-carbaldehyde;4-nitroheptanedial |
| SMILES | C.O=CC1=CCCC([N+](=O)[O-])C1.O=CCCC(CCC=O)[N+](=O)[O-] |
| InChI | InChI=1S/C7H11NO4.C7H9NO3.CH4/c9-5-1-3-7(8(11)12)4-2-6-10;9-5-6-2-1-3-7(4-6)8(10)11;/h5-7H,1-4H2;2,5,7H,1,3-4H2;1H4 |
| InChIKey | RUEYONXXRSQWRM-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 137.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.36 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze methane;5-nitrocyclohexene-1-carbaldehyde;4-nitroheptanedial with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methane;5-nitrocyclohexene-1-carbaldehyde;4-nitroheptanedial?
The IUPAC name of methane;5-nitrocyclohexene-1-carbaldehyde;4-nitroheptanedial (CID 160729962) is methane;5-nitrocyclohexene-1-carbaldehyde;4-nitroheptanedial.
What is the SMILES notation for methane;5-nitrocyclohexene-1-carbaldehyde;4-nitroheptanedial?
The canonical SMILES for methane;5-nitrocyclohexene-1-carbaldehyde;4-nitroheptanedial is C.O=CC1=CCCC([N+](=O)[O-])C1.O=CCCC(CCC=O)[N+](=O)[O-].
What is the InChIKey of methane;5-nitrocyclohexene-1-carbaldehyde;4-nitroheptanedial?
The InChIKey is RUEYONXXRSQWRM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11NO4.C7H9NO3.CH4/c9-5-1-3-7(8(11)12)4-2-6-10;9-5-6-2-1-3-7(4-6)8(10)11;/h5-7H,1-4H2;2,5,7H,1,3-4H2;1H4.
What are the key properties of methane;5-nitrocyclohexene-1-carbaldehyde;4-nitroheptanedial?
methane;5-nitrocyclohexene-1-carbaldehyde;4-nitroheptanedial has a molecular weight of 344.36 g/mol, XLogP of 2.17, 9 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for methane;5-nitrocyclohexene-1-carbaldehyde;4-nitroheptanedial is sourced from PubChem (CID 160729962), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).