About argon;ethane;1-ethyl-3-methylpyrazole
argon;ethane;1-ethyl-3-methylpyrazole (PubChem CID 160730731) has the molecular formula C18H46Ar6N2
and a molecular weight of 530.27 g/mol. Its IUPAC name is argon;ethane;1-ethyl-3-methylpyrazole.
Molecular Properties
| Compound Name | argon;ethane;1-ethyl-3-methylpyrazole |
| PubChem CID | 160730731 |
| Molecular Formula | C18H46Ar6N2 |
| Molecular Weight | 530.27 g/mol |
| Exact Mass | 530.14 |
| IUPAC Name | argon;ethane;1-ethyl-3-methylpyrazole |
| SMILES | CC.CC.CC.CC.CC.CC.CCn1ccc(C)n1.[Ar].[Ar].[Ar].[Ar].[Ar].[Ar] |
| InChI | InChI=1S/C6H10N2.6C2H6.6Ar/c1-3-8-5-4-6(2)7-8;6*1-2;;;;;;/h4-5H,3H2,1-2H3;6*1-2H3;;;;;; |
| InChIKey | RUHMYQDQTVOWIW-UHFFFAOYSA-N |
| XLogP | 7.37 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 530.27 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze argon;ethane;1-ethyl-3-methylpyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of argon;ethane;1-ethyl-3-methylpyrazole?
The IUPAC name of argon;ethane;1-ethyl-3-methylpyrazole (CID 160730731) is argon;ethane;1-ethyl-3-methylpyrazole.
What is the SMILES notation for argon;ethane;1-ethyl-3-methylpyrazole?
The canonical SMILES for argon;ethane;1-ethyl-3-methylpyrazole is CC.CC.CC.CC.CC.CC.CCn1ccc(C)n1.[Ar].[Ar].[Ar].[Ar].[Ar].[Ar].
What is the InChIKey of argon;ethane;1-ethyl-3-methylpyrazole?
The InChIKey is RUHMYQDQTVOWIW-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10N2.6C2H6.6Ar/c1-3-8-5-4-6(2)7-8;6*1-2;;;;;;/h4-5H,3H2,1-2H3;6*1-2H3;;;;;;.
What are the key properties of argon;ethane;1-ethyl-3-methylpyrazole?
argon;ethane;1-ethyl-3-methylpyrazole has a molecular weight of 530.27 g/mol, XLogP of 7.37, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for argon;ethane;1-ethyl-3-methylpyrazole is sourced from PubChem (CID 160730731), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).