C20H38BNO3 — CID 160730923
trans-(2S,3R)-N-tert-butyl-1,2-dimethyl-3-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethyl]cyclopentane-1-carboxamide (PubChem CID 160730923) has the molecular formula C20H38BNO3 and a molecular weight of 351.34 g/mol. Its IUPAC name is trans-(2S,3R)-N-tert-butyl-1,2-dimethyl-3-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethyl]cyclopentane-1-carboxamide.
| Compound Name | trans-(2S,3R)-N-tert-butyl-1,2-dimethyl-3-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethyl]cyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 160730923 |
| Molecular Formula | C20H38BNO3 |
| Molecular Weight | 351.34 g/mol |
| Exact Mass | 351.29 |
| IUPAC Name | trans-(2S,3R)-N-tert-butyl-1,2-dimethyl-3-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethyl]cyclopentane-1-carboxamide |
| SMILES | C[C@H]1[C@H](CCB2OC(C)(C)C(C)(C)O2)CCC1(C)C(=O)NC(C)(C)C |
| InChI | InChI=1S/C20H38BNO3/c1-14-15(10-12-20(14,9)16(23)22-17(2,3)4)11-13-21-24-18(5,6)19(7,8)25-21/h14-15H,10-13H2,1-9H3,(H,22,23)/t14-,15-,20?/m0/s1 |
| InChIKey | RUICGPHNUHJPKA-HGUAOMBGSA-N |
| XLogP | 4.44 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.34 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|