About azanium;trimethylazanium;dihydroxide
azanium;trimethylazanium;dihydroxide (PubChem CID 160731109) has the molecular formula C3H16N2O2
and a molecular weight of 112.17 g/mol. Its IUPAC name is azanium;trimethylazanium;dihydroxide.
Molecular Properties
| Compound Name | azanium;trimethylazanium;dihydroxide |
| PubChem CID | 160731109 |
| Molecular Formula | C3H16N2O2 |
| Molecular Weight | 112.17 g/mol |
| Exact Mass | 112.12 |
| IUPAC Name | azanium;trimethylazanium;dihydroxide |
| SMILES | C[NH+](C)C.[NH4+].[OH-].[OH-] |
| InChI | InChI=1S/C3H9N.H3N.2H2O/c1-4(2)3;;;/h1-3H3;1H3;2*1H2 |
| InChIKey | RUIUHPQZHXVANK-UHFFFAOYSA-N |
| XLogP | -1.22 |
| TPSA | 100.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 112.17 |
| LogP ≤ 5 | -1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze azanium;trimethylazanium;dihydroxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azanium;trimethylazanium;dihydroxide?
The IUPAC name of azanium;trimethylazanium;dihydroxide (CID 160731109) is azanium;trimethylazanium;dihydroxide.
What is the SMILES notation for azanium;trimethylazanium;dihydroxide?
The canonical SMILES for azanium;trimethylazanium;dihydroxide is C[NH+](C)C.[NH4+].[OH-].[OH-].
What is the InChIKey of azanium;trimethylazanium;dihydroxide?
The InChIKey is RUIUHPQZHXVANK-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H9N.H3N.2H2O/c1-4(2)3;;;/h1-3H3;1H3;2*1H2.
What are the key properties of azanium;trimethylazanium;dihydroxide?
azanium;trimethylazanium;dihydroxide has a molecular weight of 112.17 g/mol, XLogP of -1.22, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for azanium;trimethylazanium;dihydroxide is sourced from PubChem (CID 160731109), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).