About 3-[2,2-bis(2-isocyanoethoxymethyl)-3-propoxypropoxy]propanenitrile
3-[2,2-bis(2-isocyanoethoxymethyl)-3-propoxypropoxy]propanenitrile (PubChem CID 160731616) has the molecular formula C17H27N3O4
and a molecular weight of 337.42 g/mol. Its IUPAC name is 3-[2,2-bis(2-isocyanoethoxymethyl)-3-propoxypropoxy]propanenitrile.
Molecular Properties
| Compound Name | 3-[2,2-bis(2-isocyanoethoxymethyl)-3-propoxypropoxy]propanenitrile |
| PubChem CID | 160731616 |
| Molecular Formula | C17H27N3O4 |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.20 |
| IUPAC Name | 3-[2,2-bis(2-isocyanoethoxymethyl)-3-propoxypropoxy]propanenitrile |
| SMILES | [C-]#[N+]CCOCC(COCCC)(COCCC#N)COCC[N+]#[C-] |
| InChI | InChI=1S/C17H27N3O4/c1-4-9-21-13-17(14-22-10-5-6-18,15-23-11-7-19-2)16-24-12-8-20-3/h4-5,7-16H2,1H3 |
| InChIKey | RUKOCLDWBAOUCM-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 69.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 3-[2,2-bis(2-isocyanoethoxymethyl)-3-propoxypropoxy]propanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2,2-bis(2-isocyanoethoxymethyl)-3-propoxypropoxy]propanenitrile?
The IUPAC name of 3-[2,2-bis(2-isocyanoethoxymethyl)-3-propoxypropoxy]propanenitrile (CID 160731616) is 3-[2,2-bis(2-isocyanoethoxymethyl)-3-propoxypropoxy]propanenitrile.
What is the SMILES notation for 3-[2,2-bis(2-isocyanoethoxymethyl)-3-propoxypropoxy]propanenitrile?
The canonical SMILES for 3-[2,2-bis(2-isocyanoethoxymethyl)-3-propoxypropoxy]propanenitrile is [C-]#[N+]CCOCC(COCCC)(COCCC#N)COCC[N+]#[C-].
What is the InChIKey of 3-[2,2-bis(2-isocyanoethoxymethyl)-3-propoxypropoxy]propanenitrile?
The InChIKey is RUKOCLDWBAOUCM-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H27N3O4/c1-4-9-21-13-17(14-22-10-5-6-18,15-23-11-7-19-2)16-24-12-8-20-3/h4-5,7-16H2,1H3.
What are the key properties of 3-[2,2-bis(2-isocyanoethoxymethyl)-3-propoxypropoxy]propanenitrile?
3-[2,2-bis(2-isocyanoethoxymethyl)-3-propoxypropoxy]propanenitrile has a molecular weight of 337.42 g/mol, XLogP of 2.20, 16 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2,2-bis(2-isocyanoethoxymethyl)-3-propoxypropoxy]propanenitrile is sourced from PubChem (CID 160731616), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).