C55H80N2O6 — CID 160732976
3-[[6-(4-tert-butylcyclohexyl)oxynaphthalen-2-yl]methyl-propylamino]propanoic acid;methyl 3-[[6-(4-tert-butylcyclohexyl)oxynaphthalen-2-yl]methyl-propylamino]propanoate (PubChem CID 160732976) has the molecular formula C55H80N2O6 and a molecular weight of 865.25 g/mol. Its IUPAC name is 3-[[6-(4-tert-butylcyclohexyl)oxynaphthalen-2-yl]methyl-propylamino]propanoic acid;methyl 3-[[6-(4-tert-butylcyclohexyl)oxynaphthalen-2-yl]methyl-propylamino]propanoate.
| Compound Name | 3-[[6-(4-tert-butylcyclohexyl)oxynaphthalen-2-yl]methyl-propylamino]propanoic acid;methyl 3-[[6-(4-tert-butylcyclohexyl)oxynaphthalen-2-yl]methyl-propylamino]propanoate |
|---|---|
| PubChem CID | 160732976 |
| Molecular Formula | C55H80N2O6 |
| Molecular Weight | 865.25 g/mol |
| Exact Mass | 864.60 |
| IUPAC Name | 3-[[6-(4-tert-butylcyclohexyl)oxynaphthalen-2-yl]methyl-propylamino]propanoic acid;methyl 3-[[6-(4-tert-butylcyclohexyl)oxynaphthalen-2-yl]methyl-propylamino]propanoate |
| SMILES | CCCN(CCC(=O)O)Cc1ccc2cc(OC3CCC(C(C)(C)C)CC3)ccc2c1.CCCN(CCC(=O)OC)Cc1ccc2cc(OC3CCC(C(C)(C)C)CC3)ccc2c1 |
| InChI | InChI=1S/C28H41NO3.C27H39NO3/c1-6-16-29(17-15-27(30)31-5)20-21-7-8-23-19-26(12-9-22(23)18-21)32-25-13-10-24(11-14-25)28(2,3)4;1-5-15-28(16-14-26(29)30)19-20-6-7-22-18-25(11-8-21(22)17-20)31-24-12-9-23(10-13-24)27(2,3)4/h7-9,12,18-19,24-25H,6,10-11,13-17,20H2,1-5H3;6-8,11,17-18,23-24H,5,9-10,12-16,19H2,1-4H3,(H,29,30) |
| InChIKey | RUOVOYNDHQUZED-UHFFFAOYSA-N |
| XLogP | 13.11 |
| TPSA | 88.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 865.25 |
| LogP ≤ 5 | 13.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |