About 4-tert-butyl-1-ethyl-3,3-difluoropiperidine;4-tert-butyl-1-(2-fluoroethyl)piperidine
4-tert-butyl-1-ethyl-3,3-difluoropiperidine;4-tert-butyl-1-(2-fluoroethyl)piperidine (PubChem CID 160733526) has the molecular formula C22H43F3N2
and a molecular weight of 392.59 g/mol. Its IUPAC name is 4-tert-butyl-1-ethyl-3,3-difluoropiperidine;4-tert-butyl-1-(2-fluoroethyl)piperidine.
Molecular Properties
| Compound Name | 4-tert-butyl-1-ethyl-3,3-difluoropiperidine;4-tert-butyl-1-(2-fluoroethyl)piperidine |
| PubChem CID | 160733526 |
| Molecular Formula | C22H43F3N2 |
| Molecular Weight | 392.59 g/mol |
| Exact Mass | 392.34 |
| IUPAC Name | 4-tert-butyl-1-ethyl-3,3-difluoropiperidine;4-tert-butyl-1-(2-fluoroethyl)piperidine |
| SMILES | CC(C)(C)C1CCN(CCF)CC1.CCN1CCC(C(C)(C)C)C(F)(F)C1 |
| InChI | InChI=1S/C11H21F2N.C11H22FN/c1-5-14-7-6-9(10(2,3)4)11(12,13)8-14;1-11(2,3)10-4-7-13(8-5-10)9-6-12/h9H,5-8H2,1-4H3;10H,4-9H2,1-3H3 |
| InChIKey | RUQQHKXMMIBFEI-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 392.59 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-tert-butyl-1-ethyl-3,3-difluoropiperidine;4-tert-butyl-1-(2-fluoroethyl)piperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-tert-butyl-1-ethyl-3,3-difluoropiperidine;4-tert-butyl-1-(2-fluoroethyl)piperidine?
The IUPAC name of 4-tert-butyl-1-ethyl-3,3-difluoropiperidine;4-tert-butyl-1-(2-fluoroethyl)piperidine (CID 160733526) is 4-tert-butyl-1-ethyl-3,3-difluoropiperidine;4-tert-butyl-1-(2-fluoroethyl)piperidine.
What is the SMILES notation for 4-tert-butyl-1-ethyl-3,3-difluoropiperidine;4-tert-butyl-1-(2-fluoroethyl)piperidine?
The canonical SMILES for 4-tert-butyl-1-ethyl-3,3-difluoropiperidine;4-tert-butyl-1-(2-fluoroethyl)piperidine is CC(C)(C)C1CCN(CCF)CC1.CCN1CCC(C(C)(C)C)C(F)(F)C1.
What is the InChIKey of 4-tert-butyl-1-ethyl-3,3-difluoropiperidine;4-tert-butyl-1-(2-fluoroethyl)piperidine?
The InChIKey is RUQQHKXMMIBFEI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21F2N.C11H22FN/c1-5-14-7-6-9(10(2,3)4)11(12,13)8-14;1-11(2,3)10-4-7-13(8-5-10)9-6-12/h9H,5-8H2,1-4H3;10H,4-9H2,1-3H3.
What are the key properties of 4-tert-butyl-1-ethyl-3,3-difluoropiperidine;4-tert-butyl-1-(2-fluoroethyl)piperidine?
4-tert-butyl-1-ethyl-3,3-difluoropiperidine;4-tert-butyl-1-(2-fluoroethyl)piperidine has a molecular weight of 392.59 g/mol, XLogP of 5.72, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-tert-butyl-1-ethyl-3,3-difluoropiperidine;4-tert-butyl-1-(2-fluoroethyl)piperidine is sourced from PubChem (CID 160733526), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).