C13H9ClN2O2 — CID 160734232
1-[(2-chlorophenyl)methyl]-4-cyanopyrrole-2-carboxylic acid (PubChem CID 160734232) has the molecular formula C13H9ClN2O2 and a molecular weight of 260.68 g/mol. Its IUPAC name is 1-[(2-chlorophenyl)methyl]-4-cyanopyrrole-2-carboxylic acid.
| Compound Name | 1-[(2-chlorophenyl)methyl]-4-cyanopyrrole-2-carboxylic acid |
|---|---|
| PubChem CID | 160734232 |
| Molecular Formula | C13H9ClN2O2 |
| Molecular Weight | 260.68 g/mol |
| Exact Mass | 260.04 |
| IUPAC Name | 1-[(2-chlorophenyl)methyl]-4-cyanopyrrole-2-carboxylic acid |
| SMILES | N#Cc1cc(C(=O)O)n(Cc2ccccc2Cl)c1 |
| InChI | InChI=1S/C13H9ClN2O2/c14-11-4-2-1-3-10(11)8-16-7-9(6-15)5-12(16)13(17)18/h1-5,7H,8H2,(H,17,18) |
| InChIKey | RUSVHRVBCBLZSL-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.68 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |