C22H22N4O4 — CID 160735005
5-[bis(1,2-oxazol-4-ylmethyl)amino]-1-(5-phenyl-1,2-oxazol-3-yl)pentan-1-one (PubChem CID 160735005) has the molecular formula C22H22N4O4 and a molecular weight of 406.44 g/mol. Its IUPAC name is 5-[bis(1,2-oxazol-4-ylmethyl)amino]-1-(5-phenyl-1,2-oxazol-3-yl)pentan-1-one.
| Compound Name | 5-[bis(1,2-oxazol-4-ylmethyl)amino]-1-(5-phenyl-1,2-oxazol-3-yl)pentan-1-one |
|---|---|
| PubChem CID | 160735005 |
| Molecular Formula | C22H22N4O4 |
| Molecular Weight | 406.44 g/mol |
| Exact Mass | 406.16 |
| IUPAC Name | 5-[bis(1,2-oxazol-4-ylmethyl)amino]-1-(5-phenyl-1,2-oxazol-3-yl)pentan-1-one |
| SMILES | O=C(CCCCN(Cc1cnoc1)Cc1cnoc1)c1cc(-c2ccccc2)on1 |
| InChI | InChI=1S/C22H22N4O4/c27-21(20-10-22(30-25-20)19-6-2-1-3-7-19)8-4-5-9-26(13-17-11-23-28-15-17)14-18-12-24-29-16-18/h1-3,6-7,10-12,15-16H,4-5,8-9,13-14H2 |
| InChIKey | RUVHJTXFOLZBNN-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 98.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.44 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|