C34H54O4S2Si — CID 160735381
tert-butyl-[(2R)-5-ethoxy-2-ethylthiolan-3-yl]oxy-diphenylsilane;(2S)-2-[(2S)-4,4-diethoxybutan-2-yl]thiirane (PubChem CID 160735381) has the molecular formula C34H54O4S2Si and a molecular weight of 619.02 g/mol. Its IUPAC name is tert-butyl-[(2R)-5-ethoxy-2-ethylthiolan-3-yl]oxy-diphenylsilane;(2S)-2-[(2S)-4,4-diethoxybutan-2-yl]thiirane.
| Compound Name | tert-butyl-[(2R)-5-ethoxy-2-ethylthiolan-3-yl]oxy-diphenylsilane;(2S)-2-[(2S)-4,4-diethoxybutan-2-yl]thiirane |
|---|---|
| PubChem CID | 160735381 |
| Molecular Formula | C34H54O4S2Si |
| Molecular Weight | 619.02 g/mol |
| Exact Mass | 618.32 |
| IUPAC Name | tert-butyl-[(2R)-5-ethoxy-2-ethylthiolan-3-yl]oxy-diphenylsilane;(2S)-2-[(2S)-4,4-diethoxybutan-2-yl]thiirane |
| SMILES | CCOC(C[C@H](C)[C@H]1CS1)OCC.CCOC1CC(O[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)[C@@H](CC)S1 |
| InChI | InChI=1S/C24H34O2SSi.C10H20O2S/c1-6-22-21(18-23(27-22)25-7-2)26-28(24(3,4)5,19-14-10-8-11-15-19)20-16-12-9-13-17-20;1-4-11-10(12-5-2)6-8(3)9-7-13-9/h8-17,21-23H,6-7,18H2,1-5H3;8-10H,4-7H2,1-3H3/t21?,22-,23?;8-,9+/m10/s1 |
| InChIKey | RUWMMLYZEYYAQT-KGSZPKBZSA-N |
| XLogP | 7.74 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.02 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|