About acetic acid;methane;propoxycarbonyl acetate
acetic acid;methane;propoxycarbonyl acetate (PubChem CID 160736833) has the molecular formula C9H18O6
and a molecular weight of 222.24 g/mol. Its IUPAC name is acetic acid;methane;propoxycarbonyl acetate.
Molecular Properties
| Compound Name | acetic acid;methane;propoxycarbonyl acetate |
| PubChem CID | 160736833 |
| Molecular Formula | C9H18O6 |
| Molecular Weight | 222.24 g/mol |
| Exact Mass | 222.11 |
| IUPAC Name | acetic acid;methane;propoxycarbonyl acetate |
| SMILES | C.CC(=O)O.CCCOC(=O)OC(C)=O |
| InChI | InChI=1S/C6H10O4.C2H4O2.CH4/c1-3-4-9-6(8)10-5(2)7;1-2(3)4;/h3-4H2,1-2H3;1H3,(H,3,4);1H4 |
| InChIKey | FCUDCDKBUMDVLX-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.24 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze acetic acid;methane;propoxycarbonyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetic acid;methane;propoxycarbonyl acetate?
The IUPAC name of acetic acid;methane;propoxycarbonyl acetate (CID 160736833) is acetic acid;methane;propoxycarbonyl acetate.
What is the SMILES notation for acetic acid;methane;propoxycarbonyl acetate?
The canonical SMILES for acetic acid;methane;propoxycarbonyl acetate is C.CC(=O)O.CCCOC(=O)OC(C)=O.
What is the InChIKey of acetic acid;methane;propoxycarbonyl acetate?
The InChIKey is FCUDCDKBUMDVLX-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10O4.C2H4O2.CH4/c1-3-4-9-6(8)10-5(2)7;1-2(3)4;/h3-4H2,1-2H3;1H3,(H,3,4);1H4.
What are the key properties of acetic acid;methane;propoxycarbonyl acetate?
acetic acid;methane;propoxycarbonyl acetate has a molecular weight of 222.24 g/mol, XLogP of 1.82, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;methane;propoxycarbonyl acetate is sourced from PubChem (CID 160736833), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).