About propan-2-ylphosphanium;pyrrolidine;bromide
propan-2-ylphosphanium;pyrrolidine;bromide (PubChem CID 160738467) has the molecular formula C7H19BrNP
and a molecular weight of 228.11 g/mol. Its IUPAC name is propan-2-ylphosphanium;pyrrolidine;bromide.
Molecular Properties
| Compound Name | propan-2-ylphosphanium;pyrrolidine;bromide |
| PubChem CID | 160738467 |
| Molecular Formula | C7H19BrNP |
| Molecular Weight | 228.11 g/mol |
| Exact Mass | 227.04 |
| IUPAC Name | propan-2-ylphosphanium;pyrrolidine;bromide |
| SMILES | C1CCNC1.CC(C)[PH3+].[Br-] |
| InChI | InChI=1S/C4H9N.C3H9P.BrH/c1-2-4-5-3-1;1-3(2)4;/h5H,1-4H2;3H,4H2,1-2H3;1H |
| InChIKey | MLMKSBOBUIXCIG-UHFFFAOYSA-N |
| XLogP | -1.62 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.11 |
| LogP ≤ 5 | -1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze propan-2-ylphosphanium;pyrrolidine;bromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-2-ylphosphanium;pyrrolidine;bromide?
The IUPAC name of propan-2-ylphosphanium;pyrrolidine;bromide (CID 160738467) is propan-2-ylphosphanium;pyrrolidine;bromide.
What is the SMILES notation for propan-2-ylphosphanium;pyrrolidine;bromide?
The canonical SMILES for propan-2-ylphosphanium;pyrrolidine;bromide is C1CCNC1.CC(C)[PH3+].[Br-].
What is the InChIKey of propan-2-ylphosphanium;pyrrolidine;bromide?
The InChIKey is MLMKSBOBUIXCIG-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H9N.C3H9P.BrH/c1-2-4-5-3-1;1-3(2)4;/h5H,1-4H2;3H,4H2,1-2H3;1H.
What are the key properties of propan-2-ylphosphanium;pyrrolidine;bromide?
propan-2-ylphosphanium;pyrrolidine;bromide has a molecular weight of 228.11 g/mol, XLogP of -1.62, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-ylphosphanium;pyrrolidine;bromide is sourced from PubChem (CID 160738467), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).