C25H24O3S — CID 160739499
4-[3-cyclohexa-1,5-dien-1-yl-4-(4-methylphenyl)phenyl]cyclohexa-1,5-diene-1-sulfonic acid (PubChem CID 160739499) has the molecular formula C25H24O3S and a molecular weight of 404.53 g/mol. Its IUPAC name is 4-[3-cyclohexa-1,5-dien-1-yl-4-(4-methylphenyl)phenyl]cyclohexa-1,5-diene-1-sulfonic acid.
| Compound Name | 4-[3-cyclohexa-1,5-dien-1-yl-4-(4-methylphenyl)phenyl]cyclohexa-1,5-diene-1-sulfonic acid |
|---|---|
| PubChem CID | 160739499 |
| Molecular Formula | C25H24O3S |
| Molecular Weight | 404.53 g/mol |
| Exact Mass | 404.14 |
| IUPAC Name | 4-[3-cyclohexa-1,5-dien-1-yl-4-(4-methylphenyl)phenyl]cyclohexa-1,5-diene-1-sulfonic acid |
| SMILES | Cc1ccc(-c2ccc(C3C=CC(S(=O)(=O)O)=CC3)cc2C2=CCCC=C2)cc1 |
| InChI | InChI=1S/C25H24O3S/c1-18-7-9-21(10-8-18)24-16-13-22(17-25(24)20-5-3-2-4-6-20)19-11-14-23(15-12-19)29(26,27)28/h3,5-11,13-17,19H,2,4,12H2,1H3,(H,26,27,28) |
| InChIKey | KYLWANFQEXNEAZ-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.53 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|