C28H48N2O9 — CID 160739745
1-O-tert-butyl 2-O-methyl (2S,4R,5R)-5-ethenyl-4-methylpyrrolidine-1,2-dicarboxylate;1-O-tert-butyl 2-O-methyl (2S,4R,5R)-5-(2-hydroxyethyl)-4-methylpyrrolidine-1,2-dicarboxylate (PubChem CID 160739745) has the molecular formula C28H48N2O9 and a molecular weight of 556.70 g/mol. Its IUPAC name is 1-O-tert-butyl 2-O-methyl (2S,4R,5R)-5-ethenyl-4-methylpyrrolidine-1,2-dicarboxylate;1-O-tert-butyl 2-O-methyl (2S,4R,5R)-5-(2-hydroxyethyl)-4-methylpyrrolidine-1,2-dicarboxylate.
| Compound Name | 1-O-tert-butyl 2-O-methyl (2S,4R,5R)-5-ethenyl-4-methylpyrrolidine-1,2-dicarboxylate;1-O-tert-butyl 2-O-methyl (2S,4R,5R)-5-(2-hydroxyethyl)-4-methylpyrrolidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 160739745 |
| Molecular Formula | C28H48N2O9 |
| Molecular Weight | 556.70 g/mol |
| Exact Mass | 556.34 |
| IUPAC Name | 1-O-tert-butyl 2-O-methyl (2S,4R,5R)-5-ethenyl-4-methylpyrrolidine-1,2-dicarboxylate;1-O-tert-butyl 2-O-methyl (2S,4R,5R)-5-(2-hydroxyethyl)-4-methylpyrrolidine-1,2-dicarboxylate |
| SMILES | C=C[C@@H]1[C@H](C)C[C@@H](C(=O)OC)N1C(=O)OC(C)(C)C.COC(=O)[C@@H]1C[C@@H](C)[C@@H](CCO)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C14H25NO5.C14H23NO4/c1-9-8-11(12(17)19-5)15(10(9)6-7-16)13(18)20-14(2,3)4;1-7-10-9(2)8-11(12(16)18-6)15(10)13(17)19-14(3,4)5/h9-11,16H,6-8H2,1-5H3;7,9-11H,1,8H2,2-6H3/t2*9-,10-,11+/m11/s1 |
| InChIKey | RVKMMIXKWTWQCL-RXVGFGEDSA-N |
| XLogP | 3.92 |
| TPSA | 131.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.70 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|