C26H39NO10S — CID 160740125
2-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-[(1R,2R)-2-hydroxy-1-[[(1S,3S)-3-propylcyclopentanecarbonyl]amino]propyl]oxan-2-yl]sulfanylethyl 2,5-dihydroxybenzoate (PubChem CID 160740125) has the molecular formula C26H39NO10S and a molecular weight of 557.66 g/mol. Its IUPAC name is 2-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-[(1R,2R)-2-hydroxy-1-[[(1S,3S)-3-propylcyclopentanecarbonyl]amino]propyl]oxan-2-yl]sulfanylethyl 2,5-dihydroxybenzoate.
| Compound Name | 2-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-[(1R,2R)-2-hydroxy-1-[[(1S,3S)-3-propylcyclopentanecarbonyl]amino]propyl]oxan-2-yl]sulfanylethyl 2,5-dihydroxybenzoate |
|---|---|
| PubChem CID | 160740125 |
| Molecular Formula | C26H39NO10S |
| Molecular Weight | 557.66 g/mol |
| Exact Mass | 557.23 |
| IUPAC Name | 2-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-[(1R,2R)-2-hydroxy-1-[[(1S,3S)-3-propylcyclopentanecarbonyl]amino]propyl]oxan-2-yl]sulfanylethyl 2,5-dihydroxybenzoate |
| SMILES | CCC[C@H]1CC[C@H](C(=O)N[C@@H]([C@H]2O[C@H](SCCOC(=O)c3cc(O)ccc3O)[C@H](O)[C@@H](O)[C@H]2O)[C@@H](C)O)C1 |
| InChI | InChI=1S/C26H39NO10S/c1-3-4-14-5-6-15(11-14)24(34)27-19(13(2)28)23-21(32)20(31)22(33)26(37-23)38-10-9-36-25(35)17-12-16(29)7-8-18(17)30/h7-8,12-15,19-23,26,28-33H,3-6,9-11H2,1-2H3,(H,27,34)/t13-,14+,15+,19-,20+,21-,22-,23-,26-/m1/s1 |
| InChIKey | SXBCAGJBASAKKQ-NYJKHYOWSA-N |
| XLogP | 0.88 |
| TPSA | 186.01 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.66 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|