About 1,1-diethoxy-4-(methoxymethoxy)butane;4-(methoxymethoxy)butanal
1,1-diethoxy-4-(methoxymethoxy)butane;4-(methoxymethoxy)butanal (PubChem CID 160741055) has the molecular formula C16H34O7
and a molecular weight of 338.44 g/mol. Its IUPAC name is 1,1-diethoxy-4-(methoxymethoxy)butane;4-(methoxymethoxy)butanal.
Molecular Properties
| Compound Name | 1,1-diethoxy-4-(methoxymethoxy)butane;4-(methoxymethoxy)butanal |
| PubChem CID | 160741055 |
| Molecular Formula | C16H34O7 |
| Molecular Weight | 338.44 g/mol |
| Exact Mass | 338.23 |
| IUPAC Name | 1,1-diethoxy-4-(methoxymethoxy)butane;4-(methoxymethoxy)butanal |
| SMILES | CCOC(CCCOCOC)OCC.COCOCCCC=O |
| InChI | InChI=1S/C10H22O4.C6H12O3/c1-4-13-10(14-5-2)7-6-8-12-9-11-3;1-8-6-9-5-3-2-4-7/h10H,4-9H2,1-3H3;4H,2-3,5-6H2,1H3 |
| InChIKey | RVOXOPOUBDCJFM-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.44 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1,1-diethoxy-4-(methoxymethoxy)butane;4-(methoxymethoxy)butanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1-diethoxy-4-(methoxymethoxy)butane;4-(methoxymethoxy)butanal?
The IUPAC name of 1,1-diethoxy-4-(methoxymethoxy)butane;4-(methoxymethoxy)butanal (CID 160741055) is 1,1-diethoxy-4-(methoxymethoxy)butane;4-(methoxymethoxy)butanal.
What is the SMILES notation for 1,1-diethoxy-4-(methoxymethoxy)butane;4-(methoxymethoxy)butanal?
The canonical SMILES for 1,1-diethoxy-4-(methoxymethoxy)butane;4-(methoxymethoxy)butanal is CCOC(CCCOCOC)OCC.COCOCCCC=O.
What is the InChIKey of 1,1-diethoxy-4-(methoxymethoxy)butane;4-(methoxymethoxy)butanal?
The InChIKey is RVOXOPOUBDCJFM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H22O4.C6H12O3/c1-4-13-10(14-5-2)7-6-8-12-9-11-3;1-8-6-9-5-3-2-4-7/h10H,4-9H2,1-3H3;4H,2-3,5-6H2,1H3.
What are the key properties of 1,1-diethoxy-4-(methoxymethoxy)butane;4-(methoxymethoxy)butanal?
1,1-diethoxy-4-(methoxymethoxy)butane;4-(methoxymethoxy)butanal has a molecular weight of 338.44 g/mol, XLogP of 2.37, 16 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-diethoxy-4-(methoxymethoxy)butane;4-(methoxymethoxy)butanal is sourced from PubChem (CID 160741055), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).