C21H46O8 — CID 160742251
2-[2-(2-ethoxypropoxy)propoxy]propan-1-ol;2-[2-(2-methoxypropoxy)propoxy]propan-1-ol (PubChem CID 160742251) has the molecular formula C21H46O8 and a molecular weight of 426.59 g/mol. Its IUPAC name is 2-[2-(2-ethoxypropoxy)propoxy]propan-1-ol;2-[2-(2-methoxypropoxy)propoxy]propan-1-ol.
| Compound Name | 2-[2-(2-ethoxypropoxy)propoxy]propan-1-ol;2-[2-(2-methoxypropoxy)propoxy]propan-1-ol |
|---|---|
| PubChem CID | 160742251 |
| Molecular Formula | C21H46O8 |
| Molecular Weight | 426.59 g/mol |
| Exact Mass | 426.32 |
| IUPAC Name | 2-[2-(2-ethoxypropoxy)propoxy]propan-1-ol;2-[2-(2-methoxypropoxy)propoxy]propan-1-ol |
| SMILES | CCOC(C)COC(C)COC(C)CO.COC(C)COC(C)COC(C)CO |
| InChI | InChI=1S/C11H24O4.C10H22O4/c1-5-13-10(3)7-15-11(4)8-14-9(2)6-12;1-8(5-11)13-7-10(3)14-6-9(2)12-4/h9-12H,5-8H2,1-4H3;8-11H,5-7H2,1-4H3 |
| InChIKey | RVSVFBVAJCZOKW-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 95.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.59 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |