About 4-aminobenzonitrile;6-(trifluoromethyl)-1H-indole-3-sulfinate
4-aminobenzonitrile;6-(trifluoromethyl)-1H-indole-3-sulfinate (PubChem CID 160742713) has the molecular formula C16H11F3N3O2S-
and a molecular weight of 366.34 g/mol. Its IUPAC name is 4-aminobenzonitrile;6-(trifluoromethyl)-1H-indole-3-sulfinate.
Molecular Properties
| Compound Name | 4-aminobenzonitrile;6-(trifluoromethyl)-1H-indole-3-sulfinate |
| PubChem CID | 160742713 |
| Molecular Formula | C16H11F3N3O2S- |
| Molecular Weight | 366.34 g/mol |
| Exact Mass | 366.05 |
| IUPAC Name | 4-aminobenzonitrile;6-(trifluoromethyl)-1H-indole-3-sulfinate |
| SMILES | N#Cc1ccc(N)cc1.O=S([O-])c1c[nH]c2cc(C(F)(F)F)ccc12 |
| InChI | InChI=1S/C9H6F3NO2S.C7H6N2/c10-9(11,12)5-1-2-6-7(3-5)13-4-8(6)16(14)15;8-5-6-1-3-7(9)4-2-6/h1-4,13H,(H,14,15);1-4H,9H2/p-1 |
| InChIKey | QOLJTLMSSIQMPU-UHFFFAOYSA-M |
| XLogP | 3.57 |
| TPSA | 105.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 366.34 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze 4-aminobenzonitrile;6-(trifluoromethyl)-1H-indole-3-sulfinate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-aminobenzonitrile;6-(trifluoromethyl)-1H-indole-3-sulfinate?
The IUPAC name of 4-aminobenzonitrile;6-(trifluoromethyl)-1H-indole-3-sulfinate (CID 160742713) is 4-aminobenzonitrile;6-(trifluoromethyl)-1H-indole-3-sulfinate.
What is the SMILES notation for 4-aminobenzonitrile;6-(trifluoromethyl)-1H-indole-3-sulfinate?
The canonical SMILES for 4-aminobenzonitrile;6-(trifluoromethyl)-1H-indole-3-sulfinate is N#Cc1ccc(N)cc1.O=S([O-])c1c[nH]c2cc(C(F)(F)F)ccc12.
What is the InChIKey of 4-aminobenzonitrile;6-(trifluoromethyl)-1H-indole-3-sulfinate?
The InChIKey is QOLJTLMSSIQMPU-UHFFFAOYSA-M. The full InChI is InChI=1S/C9H6F3NO2S.C7H6N2/c10-9(11,12)5-1-2-6-7(3-5)13-4-8(6)16(14)15;8-5-6-1-3-7(9)4-2-6/h1-4,13H,(H,14,15);1-4H,9H2/p-1.
What are the key properties of 4-aminobenzonitrile;6-(trifluoromethyl)-1H-indole-3-sulfinate?
4-aminobenzonitrile;6-(trifluoromethyl)-1H-indole-3-sulfinate has a molecular weight of 366.34 g/mol, XLogP of 3.57, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-aminobenzonitrile;6-(trifluoromethyl)-1H-indole-3-sulfinate is sourced from PubChem (CID 160742713), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).