C20H22N2O3 — CID 160742919
4-(3,5-dimethoxy-4-propylphenyl)-2-methyl-2,7-naphthyridin-1-one (PubChem CID 160742919) has the molecular formula C20H22N2O3 and a molecular weight of 338.41 g/mol. Its IUPAC name is 4-(3,5-dimethoxy-4-propylphenyl)-2-methyl-2,7-naphthyridin-1-one.
| Compound Name | 4-(3,5-dimethoxy-4-propylphenyl)-2-methyl-2,7-naphthyridin-1-one |
|---|---|
| PubChem CID | 160742919 |
| Molecular Formula | C20H22N2O3 |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.16 |
| IUPAC Name | 4-(3,5-dimethoxy-4-propylphenyl)-2-methyl-2,7-naphthyridin-1-one |
| SMILES | CCCc1c(OC)cc(-c2cn(C)c(=O)c3cnccc23)cc1OC |
| InChI | InChI=1S/C20H22N2O3/c1-5-6-15-18(24-3)9-13(10-19(15)25-4)17-12-22(2)20(23)16-11-21-8-7-14(16)17/h7-12H,5-6H2,1-4H3 |
| InChIKey | CHULPNYLZAHRAO-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |