About (2S)-2,6-diaminohexanoic acid;4-(trifluoromethyl)benzaldehyde
(2S)-2,6-diaminohexanoic acid;4-(trifluoromethyl)benzaldehyde (PubChem CID 160743196) has the molecular formula C14H19F3N2O3
and a molecular weight of 320.31 g/mol. Its IUPAC name is (2S)-2,6-diaminohexanoic acid;4-(trifluoromethyl)benzaldehyde.
Molecular Properties
| Compound Name | (2S)-2,6-diaminohexanoic acid;4-(trifluoromethyl)benzaldehyde |
| PubChem CID | 160743196 |
| Molecular Formula | C14H19F3N2O3 |
| Molecular Weight | 320.31 g/mol |
| Exact Mass | 320.13 |
| IUPAC Name | (2S)-2,6-diaminohexanoic acid;4-(trifluoromethyl)benzaldehyde |
| SMILES | NCCCC[C@H](N)C(=O)O.O=Cc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C8H5F3O.C6H14N2O2/c9-8(10,11)7-3-1-6(5-12)2-4-7;7-4-2-1-3-5(8)6(9)10/h1-5H;5H,1-4,7-8H2,(H,9,10)/t;5-/m.0/s1 |
| InChIKey | RVVYYTLJIRJIPW-ZSCHJXSPSA-N |
| XLogP | 2.05 |
| TPSA | 106.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.31 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (2S)-2,6-diaminohexanoic acid;4-(trifluoromethyl)benzaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2,6-diaminohexanoic acid;4-(trifluoromethyl)benzaldehyde?
The IUPAC name of (2S)-2,6-diaminohexanoic acid;4-(trifluoromethyl)benzaldehyde (CID 160743196) is (2S)-2,6-diaminohexanoic acid;4-(trifluoromethyl)benzaldehyde.
What is the SMILES notation for (2S)-2,6-diaminohexanoic acid;4-(trifluoromethyl)benzaldehyde?
The canonical SMILES for (2S)-2,6-diaminohexanoic acid;4-(trifluoromethyl)benzaldehyde is NCCCC[C@H](N)C(=O)O.O=Cc1ccc(C(F)(F)F)cc1.
What is the InChIKey of (2S)-2,6-diaminohexanoic acid;4-(trifluoromethyl)benzaldehyde?
The InChIKey is RVVYYTLJIRJIPW-ZSCHJXSPSA-N. The full InChI is InChI=1S/C8H5F3O.C6H14N2O2/c9-8(10,11)7-3-1-6(5-12)2-4-7;7-4-2-1-3-5(8)6(9)10/h1-5H;5H,1-4,7-8H2,(H,9,10)/t;5-/m.0/s1.
What are the key properties of (2S)-2,6-diaminohexanoic acid;4-(trifluoromethyl)benzaldehyde?
(2S)-2,6-diaminohexanoic acid;4-(trifluoromethyl)benzaldehyde has a molecular weight of 320.31 g/mol, XLogP of 2.05, 6 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2,6-diaminohexanoic acid;4-(trifluoromethyl)benzaldehyde is sourced from PubChem (CID 160743196), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).