About 2-methylaniline;phenol;sulfane
2-methylaniline;phenol;sulfane (PubChem CID 160743803) has the molecular formula C13H17NOS
and a molecular weight of 235.35 g/mol. Its IUPAC name is 2-methylaniline;phenol;sulfane.
Molecular Properties
| Compound Name | 2-methylaniline;phenol;sulfane |
| PubChem CID | 160743803 |
| Molecular Formula | C13H17NOS |
| Molecular Weight | 235.35 g/mol |
| Exact Mass | 235.10 |
| IUPAC Name | 2-methylaniline;phenol;sulfane |
| SMILES | Cc1ccccc1N.Oc1ccccc1.S |
| InChI | InChI=1S/C7H9N.C6H6O.H2S/c1-6-4-2-3-5-7(6)8;7-6-4-2-1-3-5-6;/h2-5H,8H2,1H3;1-5,7H;1H2 |
| InChIKey | PQGAZTKHKSCLJI-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.35 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-methylaniline;phenol;sulfane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylaniline;phenol;sulfane?
The IUPAC name of 2-methylaniline;phenol;sulfane (CID 160743803) is 2-methylaniline;phenol;sulfane.
What is the SMILES notation for 2-methylaniline;phenol;sulfane?
The canonical SMILES for 2-methylaniline;phenol;sulfane is Cc1ccccc1N.Oc1ccccc1.S.
What is the InChIKey of 2-methylaniline;phenol;sulfane?
The InChIKey is PQGAZTKHKSCLJI-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9N.C6H6O.H2S/c1-6-4-2-3-5-7(6)8;7-6-4-2-1-3-5-6;/h2-5H,8H2,1H3;1-5,7H;1H2.
What are the key properties of 2-methylaniline;phenol;sulfane?
2-methylaniline;phenol;sulfane has a molecular weight of 235.35 g/mol, XLogP of 3.08, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylaniline;phenol;sulfane is sourced from PubChem (CID 160743803), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).