C22H42O13 — CID 160745287
3-(6-carboxy-3,4,5-trihydroxy-3,4,5,6-tetramethyloxan-2-yl)oxy-4,5,6-trihydroxy-2,4,5,6-tetramethyloxane-2-carboxylic acid;methane (PubChem CID 160745287) has the molecular formula C22H42O13 and a molecular weight of 514.57 g/mol. Its IUPAC name is 3-(6-carboxy-3,4,5-trihydroxy-3,4,5,6-tetramethyloxan-2-yl)oxy-4,5,6-trihydroxy-2,4,5,6-tetramethyloxane-2-carboxylic acid;methane.
| Compound Name | 3-(6-carboxy-3,4,5-trihydroxy-3,4,5,6-tetramethyloxan-2-yl)oxy-4,5,6-trihydroxy-2,4,5,6-tetramethyloxane-2-carboxylic acid;methane |
|---|---|
| PubChem CID | 160745287 |
| Molecular Formula | C22H42O13 |
| Molecular Weight | 514.57 g/mol |
| Exact Mass | 514.26 |
| IUPAC Name | 3-(6-carboxy-3,4,5-trihydroxy-3,4,5,6-tetramethyloxan-2-yl)oxy-4,5,6-trihydroxy-2,4,5,6-tetramethyloxane-2-carboxylic acid;methane |
| SMILES | C.C.CC1(C(=O)O)OC(C)(O)C(C)(O)C(C)(O)C1OC1OC(C)(C(=O)O)C(C)(O)C(C)(O)C1(C)O |
| InChI | InChI=1S/C20H34O13.2CH4/c1-13(10(21)22)9(14(2,25)18(6,28)20(8,30)33-13)31-12-15(3,26)17(5,27)19(7,29)16(4,32-12)11(23)24;;/h9,12,25-30H,1-8H3,(H,21,22)(H,23,24);2*1H4 |
| InChIKey | RWCSLCFLQGHHPW-UHFFFAOYSA-N |
| XLogP | -0.82 |
| TPSA | 223.67 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.57 |
| LogP ≤ 5 | -0.82 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 11 |