C27H31ClFNO5 — CID 160745769
ethyl 3-(4-chloro-3-fluorophenyl)-5-[4-[2-(2,5-dioxopyrrolidin-1-yl)ethoxy]-3-ethylphenyl]pentanoate (PubChem CID 160745769) has the molecular formula C27H31ClFNO5 and a molecular weight of 504.00 g/mol. Its IUPAC name is ethyl 3-(4-chloro-3-fluorophenyl)-5-[4-[2-(2,5-dioxopyrrolidin-1-yl)ethoxy]-3-ethylphenyl]pentanoate.
| Compound Name | ethyl 3-(4-chloro-3-fluorophenyl)-5-[4-[2-(2,5-dioxopyrrolidin-1-yl)ethoxy]-3-ethylphenyl]pentanoate |
|---|---|
| PubChem CID | 160745769 |
| Molecular Formula | C27H31ClFNO5 |
| Molecular Weight | 504.00 g/mol |
| Exact Mass | 503.19 |
| IUPAC Name | ethyl 3-(4-chloro-3-fluorophenyl)-5-[4-[2-(2,5-dioxopyrrolidin-1-yl)ethoxy]-3-ethylphenyl]pentanoate |
| SMILES | CCOC(=O)CC(CCc1ccc(OCCN2C(=O)CCC2=O)c(CC)c1)c1ccc(Cl)c(F)c1 |
| InChI | InChI=1S/C27H31ClFNO5/c1-3-19-15-18(6-10-24(19)35-14-13-30-25(31)11-12-26(30)32)5-7-21(17-27(33)34-4-2)20-8-9-22(28)23(29)16-20/h6,8-10,15-16,21H,3-5,7,11-14,17H2,1-2H3 |
| InChIKey | RWECZBQVTWPZHL-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.00 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|