C40H56F9N3O6 — CID 160746274
1-[(6R)-7-methyl-6-(trifluoromethyl)octyl]pyrrole-2,5-dione;1-[7-methyl-6-(trifluoromethyl)octyl]pyrrole-2,5-dione;1-[(6R)-7,7,7-trifluoro-6-methylheptyl]pyrrole-2,5-dione (PubChem CID 160746274) has the molecular formula C40H56F9N3O6 and a molecular weight of 845.88 g/mol. Its IUPAC name is 1-[(6R)-7-methyl-6-(trifluoromethyl)octyl]pyrrole-2,5-dione;1-[7-methyl-6-(trifluoromethyl)octyl]pyrrole-2,5-dione;1-[(6R)-7,7,7-trifluoro-6-methylheptyl]pyrrole-2,5-dione.
| Compound Name | 1-[(6R)-7-methyl-6-(trifluoromethyl)octyl]pyrrole-2,5-dione;1-[7-methyl-6-(trifluoromethyl)octyl]pyrrole-2,5-dione;1-[(6R)-7,7,7-trifluoro-6-methylheptyl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 160746274 |
| Molecular Formula | C40H56F9N3O6 |
| Molecular Weight | 845.88 g/mol |
| Exact Mass | 845.40 |
| IUPAC Name | 1-[(6R)-7-methyl-6-(trifluoromethyl)octyl]pyrrole-2,5-dione;1-[7-methyl-6-(trifluoromethyl)octyl]pyrrole-2,5-dione;1-[(6R)-7,7,7-trifluoro-6-methylheptyl]pyrrole-2,5-dione |
| SMILES | CC(C)C(CCCCCN1C(=O)C=CC1=O)C(F)(F)F.CC(C)[C@@H](CCCCCN1C(=O)C=CC1=O)C(F)(F)F.C[C@H](CCCCCN1C(=O)C=CC1=O)C(F)(F)F |
| InChI | InChI=1S/2C14H20F3NO2.C12H16F3NO2/c2*1-10(2)11(14(15,16)17)6-4-3-5-9-18-12(19)7-8-13(18)20;1-9(12(13,14)15)5-3-2-4-8-16-10(17)6-7-11(16)18/h2*7-8,10-11H,3-6,9H2,1-2H3;6-7,9H,2-5,8H2,1H3/t11-;;9-/m1.1/s1 |
| InChIKey | RWFQAHSQDFWMEO-FZSLGHSASA-N |
| XLogP | 9.28 |
| TPSA | 112.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 845.88 |
| LogP ≤ 5 | 9.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|