C25H33FN2O6 — CID 160747158
(E)-3-[(1S,2S,4S,5S,10S)-5-ethyl-14-fluoro-12-methoxy-18,21-dioxa-7,17-diazapentacyclo[8.7.4.01,10.02,7.011,16]henicosa-11(16),12,14-trien-4-yl]-1-hydroxy-4-methoxybut-3-en-2-one (PubChem CID 160747158) has the molecular formula C25H33FN2O6 and a molecular weight of 476.55 g/mol. Its IUPAC name is (E)-3-[(1S,2S,4S,5S,10S)-5-ethyl-14-fluoro-12-methoxy-18,21-dioxa-7,17-diazapentacyclo[8.7.4.01,10.02,7.011,16]henicosa-11(16),12,14-trien-4-yl]-1-hydroxy-4-methoxybut-3-en-2-one.
| Compound Name | (E)-3-[(1S,2S,4S,5S,10S)-5-ethyl-14-fluoro-12-methoxy-18,21-dioxa-7,17-diazapentacyclo[8.7.4.01,10.02,7.011,16]henicosa-11(16),12,14-trien-4-yl]-1-hydroxy-4-methoxybut-3-en-2-one |
|---|---|
| PubChem CID | 160747158 |
| Molecular Formula | C25H33FN2O6 |
| Molecular Weight | 476.55 g/mol |
| Exact Mass | 476.23 |
| IUPAC Name | (E)-3-[(1S,2S,4S,5S,10S)-5-ethyl-14-fluoro-12-methoxy-18,21-dioxa-7,17-diazapentacyclo[8.7.4.01,10.02,7.011,16]henicosa-11(16),12,14-trien-4-yl]-1-hydroxy-4-methoxybut-3-en-2-one |
| SMILES | CC[C@@H]1CN2CC[C@@]34OCCO[C@@]3(Nc3cc(F)cc(OC)c34)[C@@H]2C[C@@H]1/C(=C\OC)C(=O)CO |
| InChI | InChI=1S/C25H33FN2O6/c1-4-15-12-28-6-5-24-23-19(9-16(26)10-21(23)32-3)27-25(24,34-8-7-33-24)22(28)11-17(15)18(14-31-2)20(30)13-29/h9-10,14-15,17,22,27,29H,4-8,11-13H2,1-3H3/b18-14+/t15-,17+,22+,24+,25+/m1/s1 |
| InChIKey | RWIJULAEYVYTNG-OFKHVHPMSA-N |
| XLogP | 2.41 |
| TPSA | 89.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.55 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|