About benzaldehyde;benzoyl benzoate
benzaldehyde;benzoyl benzoate (PubChem CID 160747482) has the molecular formula C21H16O4
and a molecular weight of 332.36 g/mol. Its IUPAC name is benzaldehyde;benzoyl benzoate.
Molecular Properties
| Compound Name | benzaldehyde;benzoyl benzoate |
| PubChem CID | 160747482 |
| Molecular Formula | C21H16O4 |
| Molecular Weight | 332.36 g/mol |
| Exact Mass | 332.10 |
| IUPAC Name | benzaldehyde;benzoyl benzoate |
| SMILES | O=C(OC(=O)c1ccccc1)c1ccccc1.O=Cc1ccccc1 |
| InChI | InChI=1S/C14H10O3.C7H6O/c15-13(11-7-3-1-4-8-11)17-14(16)12-9-5-2-6-10-12;8-6-7-4-2-1-3-5-7/h1-10H;1-6H |
| InChIKey | RWJKJHORFBDCJN-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.36 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze benzaldehyde;benzoyl benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzaldehyde;benzoyl benzoate?
The IUPAC name of benzaldehyde;benzoyl benzoate (CID 160747482) is benzaldehyde;benzoyl benzoate.
What is the SMILES notation for benzaldehyde;benzoyl benzoate?
The canonical SMILES for benzaldehyde;benzoyl benzoate is O=C(OC(=O)c1ccccc1)c1ccccc1.O=Cc1ccccc1.
What is the InChIKey of benzaldehyde;benzoyl benzoate?
The InChIKey is RWJKJHORFBDCJN-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10O3.C7H6O/c15-13(11-7-3-1-4-8-11)17-14(16)12-9-5-2-6-10-12;8-6-7-4-2-1-3-5-7/h1-10H;1-6H.
What are the key properties of benzaldehyde;benzoyl benzoate?
benzaldehyde;benzoyl benzoate has a molecular weight of 332.36 g/mol, XLogP of 4.18, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for benzaldehyde;benzoyl benzoate is sourced from PubChem (CID 160747482), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).