C26H24ClFN6O — CID 160748072
1-[4-chloro-3-[6-(4-fluoro-3-piperidin-1-ylanilino)-1H-pyrazolo[3,4-d]pyrimidin-4-yl]phenyl]but-3-en-2-one (PubChem CID 160748072) has the molecular formula C26H24ClFN6O and a molecular weight of 490.97 g/mol. Its IUPAC name is 1-[4-chloro-3-[6-(4-fluoro-3-piperidin-1-ylanilino)-1H-pyrazolo[3,4-d]pyrimidin-4-yl]phenyl]but-3-en-2-one.
| Compound Name | 1-[4-chloro-3-[6-(4-fluoro-3-piperidin-1-ylanilino)-1H-pyrazolo[3,4-d]pyrimidin-4-yl]phenyl]but-3-en-2-one |
|---|---|
| PubChem CID | 160748072 |
| Molecular Formula | C26H24ClFN6O |
| Molecular Weight | 490.97 g/mol |
| Exact Mass | 490.17 |
| IUPAC Name | 1-[4-chloro-3-[6-(4-fluoro-3-piperidin-1-ylanilino)-1H-pyrazolo[3,4-d]pyrimidin-4-yl]phenyl]but-3-en-2-one |
| SMILES | C=CC(=O)Cc1ccc(Cl)c(-c2nc(Nc3ccc(F)c(N4CCCCC4)c3)nc3[nH]ncc23)c1 |
| InChI | InChI=1S/C26H24ClFN6O/c1-2-18(35)12-16-6-8-21(27)19(13-16)24-20-15-29-33-25(20)32-26(31-24)30-17-7-9-22(28)23(14-17)34-10-4-3-5-11-34/h2,6-9,13-15H,1,3-5,10-12H2,(H2,29,30,31,32,33) |
| InChIKey | KUWNDBWLDOSXDM-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 86.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.97 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|